C23H16N6O4S — CID 19589227
11,13-dimethyl-4-[5-[(2-nitrophenoxy)methyl]furan-2-yl]-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene (PubChem CID 19589227) has the molecular formula C23H16N6O4S and a molecular weight of 472.49 g/mol. Its IUPAC name is 11,13-dimethyl-4-[5-[(2-nitrophenoxy)methyl]furan-2-yl]-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene.
| Compound Name | 11,13-dimethyl-4-[5-[(2-nitrophenoxy)methyl]furan-2-yl]-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 19589227 |
| Molecular Formula | C23H16N6O4S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 11,13-dimethyl-4-[5-[(2-nitrophenoxy)methyl]furan-2-yl]-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
| SMILES | Cc1cc(C)c2c(n1)sc1c2ncn2nc(-c3ccc(COc4ccccc4[N+](=O)[O-])o3)nc12 |
| InChI | InChI=1S/C23H16N6O4S/c1-12-9-13(2)25-23-18(12)19-20(34-23)22-26-21(27-28(22)11-24-19)17-8-7-14(33-17)10-32-16-6-4-3-5-15(16)29(30)31/h3-9,11H,10H2,1-2H3 |
| InChIKey | HHEFVXJIBWZTFK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 121.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|