C24H15F3N6O4S — CID 19590172
11-methyl-4-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene (PubChem CID 19590172) has the molecular formula C24H15F3N6O4S and a molecular weight of 540.48 g/mol. Its IUPAC name is 11-methyl-4-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene.
| Compound Name | 11-methyl-4-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 19590172 |
| Molecular Formula | C24H15F3N6O4S |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 11-methyl-4-[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-yl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
| SMILES | Cc1cc(OCc2ccc(-c3nc4c5sc6nc(C(F)(F)F)cc(C)c6c5ncn4n3)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H15F3N6O4S/c1-11-7-13(3-5-15(11)33(34)35)36-9-14-4-6-16(37-14)21-30-22-20-19(28-10-32(22)31-21)18-12(2)8-17(24(25,26)27)29-23(18)38-20/h3-8,10H,9H2,1-2H3 |
| InChIKey | MZBODNJSHLMMPL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 121.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|