C18H13BrINO3 — CID 19590717
(4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione (PubChem CID 19590717) has the molecular formula C18H13BrINO3 and a molecular weight of 498.11 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 19590717 |
| Molecular Formula | C18H13BrINO3 |
| Molecular Weight | 498.11 g/mol |
| Exact Mass | 496.91 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione |
| SMILES | CN1C(=O)C(=O)/C(=C(\O)c2ccc(Br)cc2)C1c1ccc(I)cc1 |
| InChI | InChI=1S/C18H13BrINO3/c1-21-15(10-4-8-13(20)9-5-10)14(17(23)18(21)24)16(22)11-2-6-12(19)7-3-11/h2-9,15,22H,1H3/b16-14- |
| InChIKey | SEOVBMDSCOTWBL-PEZBUJJGSA-N |
| XLogP | 4.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.11 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|