C19H16INO3 — CID 5336851
(4E)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione (PubChem CID 5336851) has the molecular formula C19H16INO3 and a molecular weight of 433.25 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5336851 |
| Molecular Formula | C19H16INO3 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | (4E)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-iodophenyl)-1-methylpyrrolidine-2,3-dione |
| SMILES | Cc1ccc(/C(O)=C2\C(=O)C(=O)N(C)C2c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C19H16INO3/c1-11-3-5-13(6-4-11)17(22)15-16(21(2)19(24)18(15)23)12-7-9-14(20)10-8-12/h3-10,16,22H,1-2H3/b17-15+ |
| InChIKey | LPGOOTUCNXJVEF-BMRADRMJSA-N |
| XLogP | 3.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|