C14H15ClFN3O — CID 19595270
N-[(E)-2-(2-fluoro-5-methoxyphenyl)ethylideneamino]pyridin-4-amine;hydrochloride (PubChem CID 19595270) has the molecular formula C14H15ClFN3O and a molecular weight of 295.75 g/mol. Its IUPAC name is N-[(E)-2-(2-fluoro-5-methoxyphenyl)ethylideneamino]pyridin-4-amine;hydrochloride.
| Compound Name | N-[(E)-2-(2-fluoro-5-methoxyphenyl)ethylideneamino]pyridin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 19595270 |
| Molecular Formula | C14H15ClFN3O |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[(E)-2-(2-fluoro-5-methoxyphenyl)ethylideneamino]pyridin-4-amine;hydrochloride |
| SMILES | COc1ccc(F)c(C/C=N/Nc2ccncc2)c1.Cl |
| InChI | InChI=1S/C14H14FN3O.ClH/c1-19-13-2-3-14(15)11(10-13)4-9-17-18-12-5-7-16-8-6-12;/h2-3,5-10H,4H2,1H3,(H,16,18);1H/b17-9+; |
| InChIKey | WVQDRXNGTHQJLB-WWIHJBQESA-N |
| XLogP | 3.29 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|