C15H18ClN3O — CID 70106120
N-[2-(4-methoxy-3-methylphenyl)ethylideneamino]pyridin-4-amine;hydrochloride (PubChem CID 70106120) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is N-[2-(4-methoxy-3-methylphenyl)ethylideneamino]pyridin-4-amine;hydrochloride.
| Compound Name | N-[2-(4-methoxy-3-methylphenyl)ethylideneamino]pyridin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 70106120 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[2-(4-methoxy-3-methylphenyl)ethylideneamino]pyridin-4-amine;hydrochloride |
| SMILES | COc1ccc(CC=NNc2ccncc2)cc1C.Cl |
| InChI | InChI=1S/C15H17N3O.ClH/c1-12-11-13(3-4-15(12)19-2)5-10-17-18-14-6-8-16-9-7-14;/h3-4,6-11H,5H2,1-2H3,(H,16,18);1H |
| InChIKey | OPZUSDLNZWVZQC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|