C14H14FN3O — CID 70105498
N-[2-(3-fluoro-4-methoxyphenyl)ethylideneamino]pyridin-4-amine (PubChem CID 70105498) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-methoxyphenyl)ethylideneamino]pyridin-4-amine.
| Compound Name | N-[2-(3-fluoro-4-methoxyphenyl)ethylideneamino]pyridin-4-amine |
|---|---|
| PubChem CID | 70105498 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[2-(3-fluoro-4-methoxyphenyl)ethylideneamino]pyridin-4-amine |
| SMILES | COc1ccc(CC=NNc2ccncc2)cc1F |
| InChI | InChI=1S/C14H14FN3O/c1-19-14-3-2-11(10-13(14)15)4-9-17-18-12-5-7-16-8-6-12/h2-3,5-10H,4H2,1H3,(H,16,18) |
| InChIKey | BVSBLLYYYMJLBD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|