C23H23N5O2 — CID 19597381
5-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-phenoxybenzamide (PubChem CID 19597381) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 5-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-phenoxybenzamide.
| Compound Name | 5-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-phenoxybenzamide |
|---|---|
| PubChem CID | 19597381 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 5-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-phenoxybenzamide |
| SMILES | CC(C)(C)n1cc(-c2ccc(Oc3ccccc3)c(C(N)=O)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C23H23N5O2/c1-23(2,3)28-12-17(19-20(24)26-13-27-22(19)28)14-9-10-18(16(11-14)21(25)29)30-15-7-5-4-6-8-15/h4-13H,1-3H3,(H2,25,29)(H2,24,26,27) |
| InChIKey | HYYGCJCNSJGSAX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |