C23H26N6 — CID 19597480
4-N-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-1-N-methylbenzene-1,4-diamine (PubChem CID 19597480) has the molecular formula C23H26N6 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-N-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-1-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 19597480 |
| Molecular Formula | C23H26N6 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-N-[4-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-1-N-methylbenzene-1,4-diamine |
| SMILES | CNc1ccc(Nc2ccc(-c3cn(C(C)(C)C)c4ncnc(N)c34)cc2)cc1 |
| InChI | InChI=1S/C23H26N6/c1-23(2,3)29-13-19(20-21(24)26-14-27-22(20)29)15-5-7-17(8-6-15)28-18-11-9-16(25-4)10-12-18/h5-14,25,28H,1-4H3,(H2,24,26,27) |
| InChIKey | BTYLOGUNBWCOBV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|