C19H26N4 — CID 158005663
5-benzyl-7-tert-butylpyrrolo[2,3-d]pyrimidin-4-amine;ethane (PubChem CID 158005663) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is 5-benzyl-7-tert-butylpyrrolo[2,3-d]pyrimidin-4-amine;ethane.
| Compound Name | 5-benzyl-7-tert-butylpyrrolo[2,3-d]pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 158005663 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 5-benzyl-7-tert-butylpyrrolo[2,3-d]pyrimidin-4-amine;ethane |
| SMILES | CC.CC(C)(C)n1cc(Cc2ccccc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C17H20N4.C2H6/c1-17(2,3)21-10-13(9-12-7-5-4-6-8-12)14-15(18)19-11-20-16(14)21;1-2/h4-8,10-11H,9H2,1-3H3,(H2,18,19,20);1-2H3 |
| InChIKey | FEGLBUVYHVOERV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |