C20H24N4O5 — CID 158653275
1-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-[4-(trihydroxymethoxymethyl)phenyl]ethanone (PubChem CID 158653275) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-[4-(trihydroxymethoxymethyl)phenyl]ethanone.
| Compound Name | 1-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-[4-(trihydroxymethoxymethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 158653275 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-(4-amino-7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)-2-[4-(trihydroxymethoxymethyl)phenyl]ethanone |
| SMILES | CC(C)(C)n1cc(C(=O)Cc2ccc(COC(O)(O)O)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C20H24N4O5/c1-19(2,3)24-9-14(16-17(21)22-11-23-18(16)24)15(25)8-12-4-6-13(7-5-12)10-29-20(26,27)28/h4-7,9,11,26-28H,8,10H2,1-3H3,(H2,21,22,23) |
| InChIKey | IBUWQGLSKOSJMW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|