C19H21NO6 — CID 19597477
oxalic acid;1-(4-phenoxyphenyl)-2-(propan-2-ylamino)ethanone (PubChem CID 19597477) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is oxalic acid;1-(4-phenoxyphenyl)-2-(propan-2-ylamino)ethanone.
| Compound Name | oxalic acid;1-(4-phenoxyphenyl)-2-(propan-2-ylamino)ethanone |
|---|---|
| PubChem CID | 19597477 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | oxalic acid;1-(4-phenoxyphenyl)-2-(propan-2-ylamino)ethanone |
| SMILES | CC(C)NCC(=O)c1ccc(Oc2ccccc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H19NO2.C2H2O4/c1-13(2)18-12-17(19)14-8-10-16(11-9-14)20-15-6-4-3-5-7-15;3-1(4)2(5)6/h3-11,13,18H,12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | VFSBNNSFEZHDPI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|