C26H29NO2 — CID 123586640
2-[3-(4-methylpentyl)anilino]-1-(4-phenoxyphenyl)ethanone (PubChem CID 123586640) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-[3-(4-methylpentyl)anilino]-1-(4-phenoxyphenyl)ethanone.
| Compound Name | 2-[3-(4-methylpentyl)anilino]-1-(4-phenoxyphenyl)ethanone |
|---|---|
| PubChem CID | 123586640 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-[3-(4-methylpentyl)anilino]-1-(4-phenoxyphenyl)ethanone |
| SMILES | CC(C)CCCc1cccc(NCC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H29NO2/c1-20(2)8-6-9-21-10-7-11-23(18-21)27-19-26(28)22-14-16-25(17-15-22)29-24-12-4-3-5-13-24/h3-5,7,10-18,20,27H,6,8-9,19H2,1-2H3 |
| InChIKey | MYZUBAATGBBOOJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |