C20H19N3O — CID 19597503
2-amino-4-(4-phenoxyphenyl)-1-propan-2-ylpyrrole-3-carbonitrile (PubChem CID 19597503) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-amino-4-(4-phenoxyphenyl)-1-propan-2-ylpyrrole-3-carbonitrile.
| Compound Name | 2-amino-4-(4-phenoxyphenyl)-1-propan-2-ylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 19597503 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-amino-4-(4-phenoxyphenyl)-1-propan-2-ylpyrrole-3-carbonitrile |
| SMILES | CC(C)n1cc(-c2ccc(Oc3ccccc3)cc2)c(C#N)c1N |
| InChI | InChI=1S/C20H19N3O/c1-14(2)23-13-19(18(12-21)20(23)22)15-8-10-17(11-9-15)24-16-6-4-3-5-7-16/h3-11,13-14H,22H2,1-2H3 |
| InChIKey | ACWKUXDGUMRIPU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |