C18H21N5O5 — CID 19599189
2-[6-(4-hydroxyanilino)-2-methylpurin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol (PubChem CID 19599189) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[6-(4-hydroxyanilino)-2-methylpurin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-(4-hydroxyanilino)-2-methylpurin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 19599189 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[6-(4-hydroxyanilino)-2-methylpurin-9-yl]-5-(methoxymethyl)oxolane-3,4-diol |
| SMILES | COCC1OC(n2cnc3c(Nc4ccc(O)cc4)nc(C)nc32)C(O)C1O |
| InChI | InChI=1S/C18H21N5O5/c1-9-20-16(22-10-3-5-11(24)6-4-10)13-17(21-9)23(8-19-13)18-15(26)14(25)12(28-18)7-27-2/h3-6,8,12,14-15,18,24-26H,7H2,1-2H3,(H,20,21,22) |
| InChIKey | CXKQIIBWENIIMP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|