C10H17N3OS2 — CID 19600352
3-butylsulfanyl-4-pyrrolidin-3-yloxy-1,2,5-thiadiazole (PubChem CID 19600352) has the molecular formula C10H17N3OS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 3-butylsulfanyl-4-pyrrolidin-3-yloxy-1,2,5-thiadiazole.
| Compound Name | 3-butylsulfanyl-4-pyrrolidin-3-yloxy-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 19600352 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-butylsulfanyl-4-pyrrolidin-3-yloxy-1,2,5-thiadiazole |
| SMILES | CCCCSc1nsnc1OC1CCNC1 |
| InChI | InChI=1S/C10H17N3OS2/c1-2-3-6-15-10-9(12-16-13-10)14-8-4-5-11-7-8/h8,11H,2-7H2,1H3 |
| InChIKey | RXIHGLVUICOBCR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|