C32H41N5O6 — CID 19601592
1-[3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(2-ethoxyphenyl)urea;hex-2-ynedioic acid (PubChem CID 19601592) has the molecular formula C32H41N5O6 and a molecular weight of 591.71 g/mol. Its IUPAC name is 1-[3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(2-ethoxyphenyl)urea;hex-2-ynedioic acid.
| Compound Name | 1-[3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(2-ethoxyphenyl)urea;hex-2-ynedioic acid |
|---|---|
| PubChem CID | 19601592 |
| Molecular Formula | C32H41N5O6 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 1-[3-[1-(2,2-dimethylpropyl)piperidin-4-yl]-1H-pyrrolo[3,2-b]pyridin-5-yl]-3-(2-ethoxyphenyl)urea;hex-2-ynedioic acid |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc2[nH]cc(C3CCN(CC(C)(C)C)CC3)c2n1.O=C(O)C#CCCC(=O)O |
| InChI | InChI=1S/C26H35N5O2.C6H6O4/c1-5-33-22-9-7-6-8-20(22)28-25(32)30-23-11-10-21-24(29-23)19(16-27-21)18-12-14-31(15-13-18)17-26(2,3)4;7-5(8)3-1-2-4-6(9)10/h6-11,16,18,27H,5,12-15,17H2,1-4H3,(H2,28,29,30,32);1,3H2,(H,7,8)(H,9,10) |
| InChIKey | BJPFOFAGFAKAQI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|