C10H21NO — CID 19604002
2,2-dipropylmorpholine (PubChem CID 19604002) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 2,2-dipropylmorpholine.
| Compound Name | 2,2-dipropylmorpholine |
|---|---|
| PubChem CID | 19604002 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 2,2-dipropylmorpholine |
| SMILES | CCCC1(CCC)CNCCO1 |
| InChI | InChI=1S/C10H21NO/c1-3-5-10(6-4-2)9-11-7-8-12-10/h11H,3-9H2,1-2H3 |
| InChIKey | KDCIAOPXHRUDNL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |