C19H20N2O3 — CID 19605774
6-[2-(2,5-dimethoxyphenyl)ethyl]-3-methylquinazolin-4-one (PubChem CID 19605774) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-[2-(2,5-dimethoxyphenyl)ethyl]-3-methylquinazolin-4-one.
| Compound Name | 6-[2-(2,5-dimethoxyphenyl)ethyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 19605774 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 6-[2-(2,5-dimethoxyphenyl)ethyl]-3-methylquinazolin-4-one |
| SMILES | COc1ccc(OC)c(CCc2ccc3ncn(C)c(=O)c3c2)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-21-12-20-17-8-5-13(10-16(17)19(21)22)4-6-14-11-15(23-2)7-9-18(14)24-3/h5,7-12H,4,6H2,1-3H3 |
| InChIKey | JGDMQTQSNLPWPU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |