C17H18ClN3O — CID 19607927
(4-amino-2-chlorophenyl)-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone (PubChem CID 19607927) has the molecular formula C17H18ClN3O and a molecular weight of 315.80 g/mol. Its IUPAC name is (4-amino-2-chlorophenyl)-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone.
| Compound Name | (4-amino-2-chlorophenyl)-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone |
|---|---|
| PubChem CID | 19607927 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (4-amino-2-chlorophenyl)-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(N)cc2Cl)c2ccccc2C1 |
| InChI | InChI=1S/C17H18ClN3O/c1-20-8-9-21(16-5-3-2-4-12(16)11-20)17(22)14-7-6-13(19)10-15(14)18/h2-7,10H,8-9,11,19H2,1H3 |
| InChIKey | QWRMKQAFAUODMU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|