C20H21ClN2O3 — CID 15895924
methyl 2-[1-(4-amino-2-chlorobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]acetate (PubChem CID 15895924) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is methyl 2-[1-(4-amino-2-chlorobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]acetate.
| Compound Name | methyl 2-[1-(4-amino-2-chlorobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]acetate |
|---|---|
| PubChem CID | 15895924 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | methyl 2-[1-(4-amino-2-chlorobenzoyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]acetate |
| SMILES | COC(=O)CC1CCCN(C(=O)c2ccc(N)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C20H21ClN2O3/c1-26-19(24)11-13-5-4-10-23(18-7-3-2-6-15(13)18)20(25)16-9-8-14(22)12-17(16)21/h2-3,6-9,12-13H,4-5,10-11,22H2,1H3 |
| InChIKey | WVZCLHPXVZDAOD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|