C22H24N4O5S — CID 19611054
N-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 19611054) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 19611054 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2nc(C(=O)Nc3ccc(N(C)C)cc3)cs2)cc1OC |
| InChI | InChI=1S/C22H24N4O5S/c1-26(2)14-8-6-13(7-9-14)23-21(28)16-12-32-22(24-16)25-20(27)15-10-18(30-4)19(31-5)11-17(15)29-3/h6-12H,1-5H3,(H,23,28)(H,24,25,27) |
| InChIKey | BPYJAVFPALDCQL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|