C32H27ClN2O7S2 — CID 19611581
2-[[3-(1,3-benzothiazol-2-ylmethoxy)benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid (PubChem CID 19611581) has the molecular formula C32H27ClN2O7S2 and a molecular weight of 651.16 g/mol. Its IUPAC name is 2-[[3-(1,3-benzothiazol-2-ylmethoxy)benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid.
| Compound Name | 2-[[3-(1,3-benzothiazol-2-ylmethoxy)benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 19611581 |
| Molecular Formula | C32H27ClN2O7S2 |
| Molecular Weight | 651.16 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | 2-[[3-(1,3-benzothiazol-2-ylmethoxy)benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid |
| SMILES | O=C(NC(Oc1ccc(CCCS(=O)(=O)c2ccc(Cl)cc2)cc1)C(=O)O)c1cccc(OCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C32H27ClN2O7S2/c33-23-12-16-26(17-13-23)44(39,40)18-4-5-21-10-14-24(15-11-21)42-31(32(37)38)35-30(36)22-6-3-7-25(19-22)41-20-29-34-27-8-1-2-9-28(27)43-29/h1-3,6-17,19,31H,4-5,18,20H2,(H,35,36)(H,37,38) |
| InChIKey | CSMMUTLCDOULGU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.16 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|