C33H33ClN2O6S2 — CID 67596615
2-[[3-[2-(5-tert-butyl-1,3-thiazol-2-yl)ethenyl]benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid (PubChem CID 67596615) has the molecular formula C33H33ClN2O6S2 and a molecular weight of 653.22 g/mol. Its IUPAC name is 2-[[3-[2-(5-tert-butyl-1,3-thiazol-2-yl)ethenyl]benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid.
| Compound Name | 2-[[3-[2-(5-tert-butyl-1,3-thiazol-2-yl)ethenyl]benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67596615 |
| Molecular Formula | C33H33ClN2O6S2 |
| Molecular Weight | 653.22 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | 2-[[3-[2-(5-tert-butyl-1,3-thiazol-2-yl)ethenyl]benzoyl]amino]-2-[4-[3-(4-chlorophenyl)sulfonylpropyl]phenoxy]acetic acid |
| SMILES | CC(C)(C)c1cnc(C=Cc2cccc(C(=O)NC(Oc3ccc(CCCS(=O)(=O)c4ccc(Cl)cc4)cc3)C(=O)O)c2)s1 |
| InChI | InChI=1S/C33H33ClN2O6S2/c1-33(2,3)28-21-35-29(43-28)18-11-23-6-4-8-24(20-23)30(37)36-31(32(38)39)42-26-14-9-22(10-15-26)7-5-19-44(40,41)27-16-12-25(34)13-17-27/h4,6,8-18,20-21,31H,5,7,19H2,1-3H3,(H,36,37)(H,38,39) |
| InChIKey | AMECIPGYJKDJJU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.22 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|