C31H25ClN2O4S2 — CID 19611460
4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide (PubChem CID 19611460) has the molecular formula C31H25ClN2O4S2 and a molecular weight of 589.14 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide.
| Compound Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 19611460 |
| Molecular Formula | C31H25ClN2O4S2 |
| Molecular Weight | 589.14 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide |
| SMILES | O=C(Nc1cc(CCCS(=O)(=O)c2ccc(Cl)cc2)ccc1O)c1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C31H25ClN2O4S2/c32-24-13-15-25(16-14-24)40(37,38)19-3-4-22-9-17-28(35)27(20-22)34-31(36)23-11-7-21(8-12-23)10-18-30-33-26-5-1-2-6-29(26)39-30/h1-2,5-18,20,35H,3-4,19H2,(H,34,36)/b18-10+ |
| InChIKey | DBXCKFRDJNYUCY-VCHYOVAHSA-N |
| XLogP | 7.48 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.14 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|