C31H33ClN2O5S2 — CID 19611454
3-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethoxy]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide (PubChem CID 19611454) has the molecular formula C31H33ClN2O5S2 and a molecular weight of 613.20 g/mol. Its IUPAC name is 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethoxy]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide.
| Compound Name | 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethoxy]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 19611454 |
| Molecular Formula | C31H33ClN2O5S2 |
| Molecular Weight | 613.20 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethoxy]-N-[5-[3-(4-chlorophenyl)sulfonylpropyl]-2-hydroxyphenyl]benzamide |
| SMILES | CC(C)(C)c1csc(CCOc2cccc(C(=O)Nc3cc(CCCS(=O)(=O)c4ccc(Cl)cc4)ccc3O)c2)n1 |
| InChI | InChI=1S/C31H33ClN2O5S2/c1-31(2,3)28-20-40-29(34-28)15-16-39-24-8-4-7-22(19-24)30(36)33-26-18-21(9-14-27(26)35)6-5-17-41(37,38)25-12-10-23(32)11-13-25/h4,7-14,18-20,35H,5-6,15-17H2,1-3H3,(H,33,36) |
| InChIKey | VMQMMQLNMMQFNB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.20 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|