C24H29BrO8 — CID 19611747
4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one (PubChem CID 19611747) has the molecular formula C24H29BrO8 and a molecular weight of 525.39 g/mol. Its IUPAC name is 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one.
| Compound Name | 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one |
|---|---|
| PubChem CID | 19611747 |
| Molecular Formula | C24H29BrO8 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one |
| SMILES | COc1cc(C(c2cc(OC)c(OC)c(OC)c2)C2COC(=O)C2CBr)cc(OC)c1OC |
| InChI | InChI=1S/C24H29BrO8/c1-27-17-7-13(8-18(28-2)22(17)31-5)21(16-12-33-24(26)15(16)11-25)14-9-19(29-3)23(32-6)20(10-14)30-4/h7-10,15-16,21H,11-12H2,1-6H3 |
| InChIKey | MODRMYMSDVVJTD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|