About 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one
4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one (PubChem CID 19611747) has the molecular formula C24H29BrO8
and a molecular weight of 525.39 g/mol. Its IUPAC name is 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one.
Molecular Properties
| Compound Name | 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one |
| PubChem CID | 19611747 |
| Molecular Formula | C24H29BrO8 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one |
| SMILES | COc1cc(C(c2cc(OC)c(OC)c(OC)c2)C2COC(=O)C2CBr)cc(OC)c1OC |
| InChI | InChI=1S/C24H29BrO8/c1-27-17-7-13(8-18(28-2)22(17)31-5)21(16-12-33-24(26)15(16)11-25)14-9-19(29-3)23(32-6)20(10-14)30-4/h7-10,15-16,21H,11-12H2,1-6H3 |
| InChIKey | MODRMYMSDVVJTD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one?
The IUPAC name of 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one (CID 19611747) is 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one.
What is the SMILES notation for 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one?
The canonical SMILES for 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one is COc1cc(C(c2cc(OC)c(OC)c(OC)c2)C2COC(=O)C2CBr)cc(OC)c1OC.
What is the InChIKey of 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one?
The InChIKey is MODRMYMSDVVJTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29BrO8/c1-27-17-7-13(8-18(28-2)22(17)31-5)21(16-12-33-24(26)15(16)11-25)14-9-19(29-3)23(32-6)20(10-14)30-4/h7-10,15-16,21H,11-12H2,1-6H3.
What are the key properties of 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one?
4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one has a molecular weight of 525.39 g/mol, XLogP of 4.05, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(3,4,5-trimethoxyphenyl)methyl]-3-(bromomethyl)oxolan-2-one is sourced from PubChem (CID 19611747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).