C23H26O8 — CID 177490164
methyl (3S,4R)-2-oxo-4-[(R)-phenylmethoxy-(3,4,5-trimethoxyphenyl)methyl]oxolane-3-carboxylate (PubChem CID 177490164) has the molecular formula C23H26O8 and a molecular weight of 430.45 g/mol. Its IUPAC name is methyl (3S,4R)-2-oxo-4-[(R)-phenylmethoxy-(3,4,5-trimethoxyphenyl)methyl]oxolane-3-carboxylate.
| Compound Name | methyl (3S,4R)-2-oxo-4-[(R)-phenylmethoxy-(3,4,5-trimethoxyphenyl)methyl]oxolane-3-carboxylate |
|---|---|
| PubChem CID | 177490164 |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | methyl (3S,4R)-2-oxo-4-[(R)-phenylmethoxy-(3,4,5-trimethoxyphenyl)methyl]oxolane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)OC[C@@H]1[C@@H](OCc1ccccc1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H26O8/c1-26-17-10-15(11-18(27-2)21(17)28-3)20(30-12-14-8-6-5-7-9-14)16-13-31-23(25)19(16)22(24)29-4/h5-11,16,19-20H,12-13H2,1-4H3/t16-,19-,20-/m0/s1 |
| InChIKey | JBOROMQMJZZAPS-VDGAXYAQSA-N |
| XLogP | 2.93 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|