C19H17FO4 — CID 134956842
methyl (3S,4R)-4-[(S)-(4-fluorophenyl)-phenylmethyl]-2-oxooxolane-3-carboxylate (PubChem CID 134956842) has the molecular formula C19H17FO4 and a molecular weight of 328.34 g/mol. Its IUPAC name is methyl (3S,4R)-4-[(S)-(4-fluorophenyl)-phenylmethyl]-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3S,4R)-4-[(S)-(4-fluorophenyl)-phenylmethyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 134956842 |
| Molecular Formula | C19H17FO4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl (3S,4R)-4-[(S)-(4-fluorophenyl)-phenylmethyl]-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)OC[C@@H]1[C@@H](c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FO4/c1-23-18(21)17-15(11-24-19(17)22)16(12-5-3-2-4-6-12)13-7-9-14(20)10-8-13/h2-10,15-17H,11H2,1H3/t15-,16+,17+/m1/s1 |
| InChIKey | JGAYUGARTDYXBI-IKGGRYGDSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|