C9H15NO3 — CID 19611974
2-methylidenebutanoic acid;pyrrolidin-2-one (PubChem CID 19611974) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-methylidenebutanoic acid;pyrrolidin-2-one.
| Compound Name | 2-methylidenebutanoic acid;pyrrolidin-2-one |
|---|---|
| PubChem CID | 19611974 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-methylidenebutanoic acid;pyrrolidin-2-one |
| SMILES | C=C(CC)C(=O)O.O=C1CCCN1 |
| InChI | InChI=1S/C5H8O2.C4H7NO/c1-3-4(2)5(6)7;6-4-2-1-3-5-4/h2-3H2,1H3,(H,6,7);1-3H2,(H,5,6) |
| InChIKey | ATLQUKBFDKDTGH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|