C27H20N4O3S — CID 19615699
N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-6-(furan-2-yl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 19615699) has the molecular formula C27H20N4O3S and a molecular weight of 480.55 g/mol. Its IUPAC name is N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-6-(furan-2-yl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-6-(furan-2-yl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 19615699 |
| Molecular Formula | C27H20N4O3S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-6-(furan-2-yl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)c3cc(-c4ccco4)nc4onc(-c5ccccc5)c34)c2C#N)C1 |
| InChI | InChI=1S/C27H20N4O3S/c1-15-9-10-17-19(14-28)27(35-22(17)12-15)30-25(32)18-13-20(21-8-5-11-33-21)29-26-23(18)24(31-34-26)16-6-3-2-4-7-16/h2-8,11,13,15H,9-10,12H2,1H3,(H,30,32) |
| InChIKey | IIPXLUKWQQTBEF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |