C22H27N7O3 — CID 19616056
(1Z,4E)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,5-bis(1-ethyl-3-methylpyrazol-4-yl)penta-1,4-dien-3-one (PubChem CID 19616056) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is (1Z,4E)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,5-bis(1-ethyl-3-methylpyrazol-4-yl)penta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,5-bis(1-ethyl-3-methylpyrazol-4-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 19616056 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (1Z,4E)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,5-bis(1-ethyl-3-methylpyrazol-4-yl)penta-1,4-dien-3-one |
| SMILES | CCn1cc(/C=C(/C(=O)/C=C/c2cn(CC)nc2C)n2nc(C)c([N+](=O)[O-])c2C)c(C)n1 |
| InChI | InChI=1S/C22H27N7O3/c1-7-26-12-18(14(3)23-26)9-10-21(30)20(11-19-13-27(8-2)24-15(19)4)28-17(6)22(29(31)32)16(5)25-28/h9-13H,7-8H2,1-6H3/b10-9+,20-11- |
| InChIKey | WOXFNRWXSSCETR-XXJPQEPQSA-N |
| XLogP | 3.74 |
| TPSA | 113.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|