C10H8Cl3N3O — CID 19618319
4-chloro-1-[(2,6-dichlorophenoxy)methyl]pyrazol-3-amine (PubChem CID 19618319) has the molecular formula C10H8Cl3N3O and a molecular weight of 292.55 g/mol. Its IUPAC name is 4-chloro-1-[(2,6-dichlorophenoxy)methyl]pyrazol-3-amine.
| Compound Name | 4-chloro-1-[(2,6-dichlorophenoxy)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 19618319 |
| Molecular Formula | C10H8Cl3N3O |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 4-chloro-1-[(2,6-dichlorophenoxy)methyl]pyrazol-3-amine |
| SMILES | Nc1nn(COc2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl3N3O/c11-6-2-1-3-7(12)9(6)17-5-16-4-8(13)10(14)15-16/h1-4H,5H2,(H2,14,15) |
| InChIKey | ZRPXAOZWPRZOKT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |