C10H11ClN4 — CID 112650324
4-chloro-1-[(3-methyl-2-pyridinyl)methyl]pyrazol-3-amine (PubChem CID 112650324) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 4-chloro-1-[(3-methyl-2-pyridinyl)methyl]pyrazol-3-amine.
| Compound Name | 4-chloro-1-[(3-methyl-2-pyridinyl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 112650324 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-chloro-1-[(3-methyl-2-pyridinyl)methyl]pyrazol-3-amine |
| SMILES | Cc1cccnc1Cn1cc(Cl)c(N)n1 |
| InChI | InChI=1S/C10H11ClN4/c1-7-3-2-4-13-9(7)6-15-5-8(11)10(12)14-15/h2-5H,6H2,1H3,(H2,12,14) |
| InChIKey | LSGOVHZUOYJPNI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |