C9H13N5 — CID 19618531
1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-4-amine (PubChem CID 19618531) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-4-amine.
| Compound Name | 1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 19618531 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-4-amine |
| SMILES | Cc1cc(C)n(Cn2cc(N)cn2)n1 |
| InChI | InChI=1S/C9H13N5/c1-7-3-8(2)14(12-7)6-13-5-9(10)4-11-13/h3-5H,6,10H2,1-2H3 |
| InChIKey | NGYOLWNPNGNEAL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |