C16H17ClO3 — CID 19619566
5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carbonyl chloride (PubChem CID 19619566) has the molecular formula C16H17ClO3 and a molecular weight of 292.76 g/mol. Its IUPAC name is 5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carbonyl chloride.
| Compound Name | 5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carbonyl chloride |
|---|---|
| PubChem CID | 19619566 |
| Molecular Formula | C16H17ClO3 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-carbonyl chloride |
| SMILES | Cc1ccc(C(C)C)c(OCc2ccc(C(=O)Cl)o2)c1 |
| InChI | InChI=1S/C16H17ClO3/c1-10(2)13-6-4-11(3)8-15(13)19-9-12-5-7-14(20-12)16(17)18/h4-8,10H,9H2,1-3H3 |
| InChIKey | BJPNYTMNRZLKKC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|