C11H9N5OS — CID 19620217
7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 19620217) has the molecular formula C11H9N5OS and a molecular weight of 259.29 g/mol. Its IUPAC name is 7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | 7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 19620217 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | NNC(=O)c1cc2nccc(-c3cccs3)n2n1 |
| InChI | InChI=1S/C11H9N5OS/c12-14-11(17)7-6-10-13-4-3-8(16(10)15-7)9-2-1-5-18-9/h1-6H,12H2,(H,14,17) |
| InChIKey | ZZVCOLLBQBIXTG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|