C16H18O2S — CID 19621693
4-[(3,4-dimethylphenoxy)methyl]-5-ethylthiophene-2-carbaldehyde (PubChem CID 19621693) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenoxy)methyl]-5-ethylthiophene-2-carbaldehyde.
| Compound Name | 4-[(3,4-dimethylphenoxy)methyl]-5-ethylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 19621693 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-[(3,4-dimethylphenoxy)methyl]-5-ethylthiophene-2-carbaldehyde |
| SMILES | CCc1sc(C=O)cc1COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H18O2S/c1-4-16-13(8-15(9-17)19-16)10-18-14-6-5-11(2)12(3)7-14/h5-9H,4,10H2,1-3H3 |
| InChIKey | IXSZGRJZWNTGKE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|