cyclopentane-1,2,3,4-tetracarboxylic acid

C9H10O8 — CID 19622

IUPACcyclopentane-1,2,3,4-tetracarboxylic acid
SMILESO=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O
InChIInChI=1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)
InChIKeyWOSVXXBNNCUXMT-UHFFFAOYSA-N
MW246.17 g/mol
LogP-0.81
Rot. Bonds4

About cyclopentane-1,2,3,4-tetracarboxylic acid

cyclopentane-1,2,3,4-tetracarboxylic acid (PubChem CID 19622) has the molecular formula C9H10O8 and a molecular weight of 246.17 g/mol. Its IUPAC name is cyclopentane-1,2,3,4-tetracarboxylic acid.

Molecular Properties

Compound Namecyclopentane-1,2,3,4-tetracarboxylic acid
PubChem CID19622
Molecular FormulaC9H10O8
Molecular Weight246.17 g/mol
Exact Mass246.04
IUPAC Namecyclopentane-1,2,3,4-tetracarboxylic acid
SMILESO=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O
InChIInChI=1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)
InChIKeyWOSVXXBNNCUXMT-UHFFFAOYSA-N
XLogP-0.81
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.17
LogP ≤ 5-0.81
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze cyclopentane-1,2,3,4-tetracarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1,2-Cyclopentanedicarboxylic acid, (1R,2R)-rel-
CID 727375
(1R,2R,3S,1'R)-Nepetalinic acid
CID 15560389
rel-(1R,2R)-4-Oxo-1,2-cyclopentanedicarboxylic acid
CID 13235311
1,2-Cyclopentanedicarboxylate
CID 89554
rel-(1R,2R,3S,4S)-1,2,3,4-Cyclopentanetetracarboxylic acid
CID 252253
cis-Cyclopentane-1,2-dicarboxylic acid
CID 727374
cis-4-Oxocyclopentane-1,2-dicarboxylicacid
CID 27443853
(1R,2R,5S)-2-[(1S)-1-carboxyethyl]-5-methylcyclopentane-1-carboxylic acid
CID 131215292
(1S,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylic acid
CID 1268114
4-Oxo-1,2-cyclopentanedicarboxylic acid
CID 287120
4-Methylcyclopentane-1,2-dicarboxylic acid
CID 70334041
(1S,2S,5S)-2-(1-carboxyethyl)-5-methylcyclopentane-1-carboxylic acid
CID 101277407

Frequently Asked Questions

What is the IUPAC name of cyclopentane-1,2,3,4-tetracarboxylic acid?
The IUPAC name of cyclopentane-1,2,3,4-tetracarboxylic acid (CID 19622) is cyclopentane-1,2,3,4-tetracarboxylic acid.
What is the SMILES notation for cyclopentane-1,2,3,4-tetracarboxylic acid?
The canonical SMILES for cyclopentane-1,2,3,4-tetracarboxylic acid is O=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O.
What is the InChIKey of cyclopentane-1,2,3,4-tetracarboxylic acid?
The InChIKey is WOSVXXBNNCUXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17).
What are the key properties of cyclopentane-1,2,3,4-tetracarboxylic acid?
cyclopentane-1,2,3,4-tetracarboxylic acid has a molecular weight of 246.17 g/mol, XLogP of -0.81, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane-1,2,3,4-tetracarboxylic acid is sourced from PubChem (CID 19622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).