C16H18F3N3S — CID 19627017
2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)aniline (PubChem CID 19627017) has the molecular formula C16H18F3N3S and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 19627017 |
| Molecular Formula | C16H18F3N3S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H18F3N3S/c17-16(18,19)12-3-4-15(14(20)10-12)22-7-5-21(6-8-22)11-13-2-1-9-23-13/h1-4,9-10H,5-8,11,20H2 |
| InChIKey | JBHKOASNIPWRCW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|