C17H20FN5 — CID 19627709
1-(2-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine (PubChem CID 19627709) has the molecular formula C17H20FN5 and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-(2-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine.
| Compound Name | 1-(2-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 19627709 |
| Molecular Formula | C17H20FN5 |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-(2-ethylpyrazol-3-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine |
| SMILES | CCn1nccc1C(C)NCc1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C17H20FN5/c1-3-23-17(8-9-20-23)12(2)19-11-15-10-16(22-21-15)13-4-6-14(18)7-5-13/h4-10,12,19H,3,11H2,1-2H3,(H,21,22) |
| InChIKey | FGTOILKHHKQSFH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |