C18H22FN5 — CID 19627712
1-(1-ethyl-3-methylpyrazol-4-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine (PubChem CID 19627712) has the molecular formula C18H22FN5 and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(1-ethyl-3-methylpyrazol-4-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine.
| Compound Name | 1-(1-ethyl-3-methylpyrazol-4-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 19627712 |
| Molecular Formula | C18H22FN5 |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-(1-ethyl-3-methylpyrazol-4-yl)-N-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]ethanamine |
| SMILES | CCn1cc(C(C)NCc2cc(-c3ccc(F)cc3)n[nH]2)c(C)n1 |
| InChI | InChI=1S/C18H22FN5/c1-4-24-11-17(13(3)23-24)12(2)20-10-16-9-18(22-21-16)14-5-7-15(19)8-6-14/h5-9,11-12,20H,4,10H2,1-3H3,(H,21,22) |
| InChIKey | QVZGSJZNQRNZQF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |