C13H22O — CID 19633
6,10-dimethylundeca-5,9-dien-2-one (PubChem CID 19633) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 6,10-dimethylundeca-5,9-dien-2-one.
| Compound Name | 6,10-dimethylundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 19633 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 6,10-dimethylundeca-5,9-dien-2-one |
| SMILES | CC(=O)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C13H22O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9H,5-6,8,10H2,1-4H3 |
| InChIKey | HNZUNIKWNYHEJJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|