C11H18O — CID 6536892
(3E)-4,8-dimethylnona-3,7-dien-2-one (PubChem CID 6536892) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3E)-4,8-dimethylnona-3,7-dien-2-one.
| Compound Name | (3E)-4,8-dimethylnona-3,7-dien-2-one |
|---|---|
| PubChem CID | 6536892 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3E)-4,8-dimethylnona-3,7-dien-2-one |
| SMILES | CC(=O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C11H18O/c1-9(2)6-5-7-10(3)8-11(4)12/h6,8H,5,7H2,1-4H3/b10-8+ |
| InChIKey | QAFYGHBGWCPRCI-CSKARUKUSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|