C20H26N6O2S2 — CID 19636995
2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 19636995) has the molecular formula C20H26N6O2S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19636995 |
| Molecular Formula | C20H26N6O2S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)CSc2nnc(C(C)Oc3ccc(C)c(C)c3)n2CC)s1 |
| InChI | InChI=1S/C20H26N6O2S2/c1-6-17-22-24-19(30-17)21-16(27)11-29-20-25-23-18(26(20)7-2)14(5)28-15-9-8-12(3)13(4)10-15/h8-10,14H,6-7,11H2,1-5H3,(H,21,24,27) |
| InChIKey | CRAYUCJLANYUHP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |