C27H31N5O2S2 — CID 17306164
2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 17306164) has the molecular formula C27H31N5O2S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is 2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17306164 |
| Molecular Formula | C27H31N5O2S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2nc(-c3ccc(C)c(C)c3)cs2)nnc1C(C)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C27H31N5O2S2/c1-7-32-25(20(6)34-22-11-9-17(3)19(5)13-22)30-31-27(32)36-15-24(33)29-26-28-23(14-35-26)21-10-8-16(2)18(4)12-21/h8-14,20H,7,15H2,1-6H3,(H,28,29,33) |
| InChIKey | OSSWYMOJWTZFJS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |