C23H25N5OS3 — CID 19720861
N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19720861) has the molecular formula C23H25N5OS3 and a molecular weight of 483.69 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19720861 |
| Molecular Formula | C23H25N5OS3 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2nc(-c3ccc(C)c(C)c3)cs2)nnc1-c1csc(C)c1C |
| InChI | InChI=1S/C23H25N5OS3/c1-6-28-21(18-10-30-16(5)15(18)4)26-27-23(28)32-12-20(29)25-22-24-19(11-31-22)17-8-7-13(2)14(3)9-17/h7-11H,6,12H2,1-5H3,(H,24,25,29) |
| InChIKey | FOPSNYMYMKTBTQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |