C20H25FN4O2S — CID 19640639
N-cyclopentyl-2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19640639) has the molecular formula C20H25FN4O2S and a molecular weight of 404.51 g/mol. Its IUPAC name is N-cyclopentyl-2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19640639 |
| Molecular Formula | C20H25FN4O2S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-cyclopentyl-2-[[5-[1-(4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC2CCCC2)nnc1C(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O2S/c1-3-12-25-19(14(2)27-17-10-8-15(21)9-11-17)23-24-20(25)28-13-18(26)22-16-6-4-5-7-16/h3,8-11,14,16H,1,4-7,12-13H2,2H3,(H,22,26) |
| InChIKey | FMRJCYOMOCXCEA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|