C20H25N3O4 — CID 19644382
N-[3-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylamino]phenyl]-2-methylpropanamide (PubChem CID 19644382) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[3-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylamino]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylamino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 19644382 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[3-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylamino]phenyl]-2-methylpropanamide |
| SMILES | COc1cc(CNc2cccc(NC(=O)C(C)C)c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C20H25N3O4/c1-13(2)20(25)23-16-6-4-5-15(10-16)22-11-14-7-8-17(18(9-14)26-3)27-12-19(21)24/h4-10,13,22H,11-12H2,1-3H3,(H2,21,24)(H,23,25) |
| InChIKey | KCKOMTSUDHJPRM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |