C31H23NO8 — CID 19646012
[4-[2-[2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)benzoyl]oxyacetyl]phenyl] furan-2-carboxylate (PubChem CID 19646012) has the molecular formula C31H23NO8 and a molecular weight of 537.52 g/mol. Its IUPAC name is [4-[2-[2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)benzoyl]oxyacetyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-[2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)benzoyl]oxyacetyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19646012 |
| Molecular Formula | C31H23NO8 |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | [4-[2-[2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)benzoyl]oxyacetyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccccc1N1C(=O)C2C3C=CC(C4CC34)C2C1=O)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C31H23NO8/c33-24(16-7-9-17(10-8-16)40-31(37)25-6-3-13-38-25)15-39-30(36)20-4-1-2-5-23(20)32-28(34)26-18-11-12-19(22-14-21(18)22)27(26)29(32)35/h1-13,18-19,21-22,26-27H,14-15H2 |
| InChIKey | DZVVIAXUHAFDRB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|